C21H18N2O4 — CID 47051952
N-[3-(3,4-dihydro-2H-chromen-4-ylcarbamoyl)phenyl]furan-2-carboxamide (PubChem CID 47051952) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-chromen-4-ylcarbamoyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-2H-chromen-4-ylcarbamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 47051952 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-chromen-4-ylcarbamoyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(NC1CCOc2ccccc21)c1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C21H18N2O4/c24-20(23-17-10-12-27-18-8-2-1-7-16(17)18)14-5-3-6-15(13-14)22-21(25)19-9-4-11-26-19/h1-9,11,13,17H,10,12H2,(H,22,25)(H,23,24) |
| InChIKey | ZMXGYEJAZIXXQM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |