C17H18N4O5 — CID 47055040
N-[3-(furan-2-ylmethoxy)propyl]-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide (PubChem CID 47055040) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethoxy)propyl]-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N-[3-(furan-2-ylmethoxy)propyl]-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 47055040 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[3-(furan-2-ylmethoxy)propyl]-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide |
| SMILES | Cn1c(=O)[nH]c(=O)c2ccc(C(=O)NCCCOCc3ccco3)nc21 |
| InChI | InChI=1S/C17H18N4O5/c1-21-14-12(15(22)20-17(21)24)5-6-13(19-14)16(23)18-7-3-8-25-10-11-4-2-9-26-11/h2,4-6,9H,3,7-8,10H2,1H3,(H,18,23)(H,20,22,24) |
| InChIKey | PGLPKAFQEIBSPC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|