C16H22N4O5 — CID 55929786
N-[3-(2-methoxyethoxy)propyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide (PubChem CID 55929786) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)propyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N-[3-(2-methoxyethoxy)propyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 55929786 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[3-(2-methoxyethoxy)propyl]-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide |
| SMILES | COCCOCCCNC(=O)c1ccc2c(=O)n(C)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C16H22N4O5/c1-19-13-11(15(22)20(2)16(19)23)5-6-12(18-13)14(21)17-7-4-8-25-10-9-24-3/h5-6H,4,7-10H2,1-3H3,(H,17,21) |
| InChIKey | KLOAGLGTNZBXAL-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|