C15H13F2NO3 — CID 47056492
4-(2,4-difluorophenyl)-N-(furan-3-ylmethyl)-4-oxobutanamide (PubChem CID 47056492) has the molecular formula C15H13F2NO3 and a molecular weight of 293.27 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-N-(furan-3-ylmethyl)-4-oxobutanamide.
| Compound Name | 4-(2,4-difluorophenyl)-N-(furan-3-ylmethyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 47056492 |
| Molecular Formula | C15H13F2NO3 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 4-(2,4-difluorophenyl)-N-(furan-3-ylmethyl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(F)cc1F)NCc1ccoc1 |
| InChI | InChI=1S/C15H13F2NO3/c16-11-1-2-12(13(17)7-11)14(19)3-4-15(20)18-8-10-5-6-21-9-10/h1-2,5-7,9H,3-4,8H2,(H,18,20) |
| InChIKey | NWPOSVBUPBDYCV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |