C18H14ClN3O3 — CID 47062367
N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-1-methylindole-2-carboxamide (PubChem CID 47062367) has the molecular formula C18H14ClN3O3 and a molecular weight of 355.78 g/mol. Its IUPAC name is N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-1-methylindole-2-carboxamide.
| Compound Name | N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 47062367 |
| Molecular Formula | C18H14ClN3O3 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2cc3c(cc2Cl)NC(=O)CO3)cc2ccccc21 |
| InChI | InChI=1S/C18H14ClN3O3/c1-22-14-5-3-2-4-10(14)6-15(22)18(24)21-12-8-16-13(7-11(12)19)20-17(23)9-25-16/h2-8H,9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | HCNVZJSCPPACQO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |