C18H19FN4O4 — CID 47067843
2-amino-N-[2-(2-ethylanilino)-2-oxoethyl]-5-fluoro-N-methyl-3-nitrobenzamide (PubChem CID 47067843) has the molecular formula C18H19FN4O4 and a molecular weight of 374.37 g/mol. Its IUPAC name is 2-amino-N-[2-(2-ethylanilino)-2-oxoethyl]-5-fluoro-N-methyl-3-nitrobenzamide.
| Compound Name | 2-amino-N-[2-(2-ethylanilino)-2-oxoethyl]-5-fluoro-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 47067843 |
| Molecular Formula | C18H19FN4O4 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-amino-N-[2-(2-ethylanilino)-2-oxoethyl]-5-fluoro-N-methyl-3-nitrobenzamide |
| SMILES | CCc1ccccc1NC(=O)CN(C)C(=O)c1cc(F)cc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C18H19FN4O4/c1-3-11-6-4-5-7-14(11)21-16(24)10-22(2)18(25)13-8-12(19)9-15(17(13)20)23(26)27/h4-9H,3,10,20H2,1-2H3,(H,21,24) |
| InChIKey | PSEBWKCLAWJFCI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|