C23H21F2N3O5 — CID 47071352
ethyl 1-[4-[[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]phenyl]pyrazole-3-carboxylate (PubChem CID 47071352) has the molecular formula C23H21F2N3O5 and a molecular weight of 457.43 g/mol. Its IUPAC name is ethyl 1-[4-[[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-[4-[[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 47071352 |
| Molecular Formula | C23H21F2N3O5 |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | ethyl 1-[4-[[(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccn(-c2ccc(NC(=O)/C=C/c3cccc(OC)c3OC(F)F)cc2)n1 |
| InChI | InChI=1S/C23H21F2N3O5/c1-3-32-22(30)18-13-14-28(27-18)17-10-8-16(9-11-17)26-20(29)12-7-15-5-4-6-19(31-2)21(15)33-23(24)25/h4-14,23H,3H2,1-2H3,(H,26,29)/b12-7+ |
| InChIKey | YVXZIXJIVUUYEN-KPKJPENVSA-N |
| XLogP | 4.31 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|