C18H20ClNO4S2 — CID 47071942
N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-methylsulfonylbenzenesulfonamide (PubChem CID 47071942) has the molecular formula C18H20ClNO4S2 and a molecular weight of 413.95 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 47071942 |
| Molecular Formula | C18H20ClNO4S2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-methylsulfonylbenzenesulfonamide |
| SMILES | CC(c1ccc(Cl)cc1)N(C1CC1)S(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H20ClNO4S2/c1-13(14-3-5-15(19)6-4-14)20(16-7-8-16)26(23,24)18-11-9-17(10-12-18)25(2,21)22/h3-6,9-13,16H,7-8H2,1-2H3 |
| InChIKey | LCLJEUASXRJUBR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |