C20H24ClNO4S — CID 47071943
N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-(2-methoxyethoxy)benzenesulfonamide (PubChem CID 47071943) has the molecular formula C20H24ClNO4S and a molecular weight of 409.94 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-(2-methoxyethoxy)benzenesulfonamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-(2-methoxyethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 47071943 |
| Molecular Formula | C20H24ClNO4S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-(2-methoxyethoxy)benzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)N(C2CC2)C(C)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H24ClNO4S/c1-15(16-3-5-17(21)6-4-16)22(18-7-8-18)27(23,24)20-11-9-19(10-12-20)26-14-13-25-2/h3-6,9-12,15,18H,7-8,13-14H2,1-2H3 |
| InChIKey | DUMRMDTUVGPTSU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|