C16H20Cl2N2O — CID 47076999
N-(1-cyclopropylpyrrolidin-3-yl)-3-(2,3-dichlorophenyl)propanamide (PubChem CID 47076999) has the molecular formula C16H20Cl2N2O and a molecular weight of 327.25 g/mol. Its IUPAC name is N-(1-cyclopropylpyrrolidin-3-yl)-3-(2,3-dichlorophenyl)propanamide.
| Compound Name | N-(1-cyclopropylpyrrolidin-3-yl)-3-(2,3-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 47076999 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-(1-cyclopropylpyrrolidin-3-yl)-3-(2,3-dichlorophenyl)propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1Cl)NC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C16H20Cl2N2O/c17-14-3-1-2-11(16(14)18)4-7-15(21)19-12-8-9-20(10-12)13-5-6-13/h1-3,12-13H,4-10H2,(H,19,21) |
| InChIKey | HRIMZJNUVCLKLT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |