C15H17Cl2NO2 — CID 111661405
3-(2,3-dichlorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide (PubChem CID 111661405) has the molecular formula C15H17Cl2NO2 and a molecular weight of 314.21 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide.
| Compound Name | 3-(2,3-dichlorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide |
|---|---|
| PubChem CID | 111661405 |
| Molecular Formula | C15H17Cl2NO2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1Cl)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C15H17Cl2NO2/c16-13-3-1-2-11(15(13)17)5-7-14(20)18-12-6-4-10(8-12)9-19/h1-4,6,10,12,19H,5,7-9H2,(H,18,20)/t10-,12+/m0/s1 |
| InChIKey | OBTVAMWTRVNPNP-CMPLNLGQSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|