C26H32N4O4S — CID 47078761
3-(azepan-1-ylsulfonyl)-N-[1-(3-methoxyphenyl)ethyl]-N-(1-methylpyrazol-4-yl)benzamide (PubChem CID 47078761) has the molecular formula C26H32N4O4S and a molecular weight of 496.63 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-N-[1-(3-methoxyphenyl)ethyl]-N-(1-methylpyrazol-4-yl)benzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-N-[1-(3-methoxyphenyl)ethyl]-N-(1-methylpyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 47078761 |
| Molecular Formula | C26H32N4O4S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-N-[1-(3-methoxyphenyl)ethyl]-N-(1-methylpyrazol-4-yl)benzamide |
| SMILES | COc1cccc(C(C)N(C(=O)c2cccc(S(=O)(=O)N3CCCCCC3)c2)c2cnn(C)c2)c1 |
| InChI | InChI=1S/C26H32N4O4S/c1-20(21-10-8-12-24(16-21)34-3)30(23-18-27-28(2)19-23)26(31)22-11-9-13-25(17-22)35(32,33)29-14-6-4-5-7-15-29/h8-13,16-20H,4-7,14-15H2,1-3H3 |
| InChIKey | FUIJGSMZWYUAOU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |