About N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide
N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide (PubChem CID 47081595) has the molecular formula C14H15F3N2O3
and a molecular weight of 316.28 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide |
| PubChem CID | 47081595 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccccc1NC(=O)C1CCOC1 |
| InChI | InChI=1S/C14H15F3N2O3/c15-14(16,17)8-18-13(21)10-3-1-2-4-11(10)19-12(20)9-5-6-22-7-9/h1-4,9H,5-8H2,(H,18,21)(H,19,20) |
| InChIKey | YHKCLECMAXHFQB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide?
The IUPAC name of N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide (CID 47081595) is N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide.
What is the SMILES notation for N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide?
The canonical SMILES for N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide is O=C(NCC(F)(F)F)c1ccccc1NC(=O)C1CCOC1.
What is the InChIKey of N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide?
The InChIKey is YHKCLECMAXHFQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N2O3/c15-14(16,17)8-18-13(21)10-3-1-2-4-11(10)19-12(20)9-5-6-22-7-9/h1-4,9H,5-8H2,(H,18,21)(H,19,20).
What are the key properties of N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide?
N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide has a molecular weight of 316.28 g/mol, XLogP of 1.95, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]oxolane-3-carboxamide is sourced from PubChem (CID 47081595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).