C20H18N2O5S — CID 47083523
N-(furan-2-ylmethyl)-4-(furan-2-ylmethylsulfamoyl)-N-prop-2-ynylbenzamide (PubChem CID 47083523) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(furan-2-ylmethylsulfamoyl)-N-prop-2-ynylbenzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(furan-2-ylmethylsulfamoyl)-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 47083523 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(furan-2-ylmethylsulfamoyl)-N-prop-2-ynylbenzamide |
| SMILES | C#CCN(Cc1ccco1)C(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C20H18N2O5S/c1-2-11-22(15-18-6-4-13-27-18)20(23)16-7-9-19(10-8-16)28(24,25)21-14-17-5-3-12-26-17/h1,3-10,12-13,21H,11,14-15H2 |
| InChIKey | MBNCJSBWTHGLQW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|