About 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one
3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one (PubChem CID 47086044) has the molecular formula C21H21N3O3
and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one |
| PubChem CID | 47086044 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one |
| SMILES | CCOc1ccc2c(c1)CN(C(=O)Cn1cnc3ccccc3c1=O)CC2 |
| InChI | InChI=1S/C21H21N3O3/c1-2-27-17-8-7-15-9-10-23(12-16(15)11-17)20(25)13-24-14-22-19-6-4-3-5-18(19)21(24)26/h3-8,11,14H,2,9-10,12-13H2,1H3 |
| InChIKey | LYRXNEMXWJXUSL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one?
The IUPAC name of 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one (CID 47086044) is 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one.
What is the SMILES notation for 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one?
The canonical SMILES for 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one is CCOc1ccc2c(c1)CN(C(=O)Cn1cnc3ccccc3c1=O)CC2.
What is the InChIKey of 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one?
The InChIKey is LYRXNEMXWJXUSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O3/c1-2-27-17-8-7-15-9-10-23(12-16(15)11-17)20(25)13-24-14-22-19-6-4-3-5-18(19)21(24)26/h3-8,11,14H,2,9-10,12-13H2,1H3.
What are the key properties of 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one?
3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one has a molecular weight of 363.42 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(7-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]quinazolin-4-one is sourced from PubChem (CID 47086044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).