C21H25N5O4 — CID 47090500
N-[3-[[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylcarbamoylamino]methyl]phenyl]furan-2-carboxamide (PubChem CID 47090500) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[3-[[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylcarbamoylamino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylcarbamoylamino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 47090500 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-[3-[[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propylcarbamoylamino]methyl]phenyl]furan-2-carboxamide |
| SMILES | CC(C)c1noc(CCCNC(=O)NCc2cccc(NC(=O)c3ccco3)c2)n1 |
| InChI | InChI=1S/C21H25N5O4/c1-14(2)19-25-18(30-26-19)9-4-10-22-21(28)23-13-15-6-3-7-16(12-15)24-20(27)17-8-5-11-29-17/h3,5-8,11-12,14H,4,9-10,13H2,1-2H3,(H,24,27)(H2,22,23,28) |
| InChIKey | WJAVAVWWMCRQHG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|