C12H14Cl2N2O3 — CID 47123964
propan-2-yl 3-[(3,6-dichloropyridine-2-carbonyl)amino]propanoate (PubChem CID 47123964) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is propan-2-yl 3-[(3,6-dichloropyridine-2-carbonyl)amino]propanoate.
| Compound Name | propan-2-yl 3-[(3,6-dichloropyridine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 47123964 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | propan-2-yl 3-[(3,6-dichloropyridine-2-carbonyl)amino]propanoate |
| SMILES | CC(C)OC(=O)CCNC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O3/c1-7(2)19-10(17)5-6-15-12(18)11-8(13)3-4-9(14)16-11/h3-4,7H,5-6H2,1-2H3,(H,15,18) |
| InChIKey | SBARDJJBJPDOBT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|