C15H14ClNO2 — CID 47124146
(2,3,6-trimethylphenyl) 2-chloropyridine-4-carboxylate (PubChem CID 47124146) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) 2-chloropyridine-4-carboxylate.
| Compound Name | (2,3,6-trimethylphenyl) 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 47124146 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | (2,3,6-trimethylphenyl) 2-chloropyridine-4-carboxylate |
| SMILES | Cc1ccc(C)c(OC(=O)c2ccnc(Cl)c2)c1C |
| InChI | InChI=1S/C15H14ClNO2/c1-9-4-5-10(2)14(11(9)3)19-15(18)12-6-7-17-13(16)8-12/h4-8H,1-3H3 |
| InChIKey | BMQGTMRPMSCWOW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|