C16H23NO3 — CID 4713255
8-[2-(tert-butylamino)-1-hydroxyethoxy]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 4713255) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 8-[2-(tert-butylamino)-1-hydroxyethoxy]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 8-[2-(tert-butylamino)-1-hydroxyethoxy]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 4713255 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 8-[2-(tert-butylamino)-1-hydroxyethoxy]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(C)(C)NCC(O)Oc1cccc2c1C(=O)CCC2 |
| InChI | InChI=1S/C16H23NO3/c1-16(2,3)17-10-14(19)20-13-9-5-7-11-6-4-8-12(18)15(11)13/h5,7,9,14,17,19H,4,6,8,10H2,1-3H3 |
| InChIKey | FAAVDEZSUNCBFS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|