C8H11ClN2S — CID 47137517
2-chloro-N-cyclopentyl-1,3-thiazol-4-amine (PubChem CID 47137517) has the molecular formula C8H11ClN2S and a molecular weight of 202.71 g/mol. Its IUPAC name is 2-chloro-N-cyclopentyl-1,3-thiazol-4-amine.
| Compound Name | 2-chloro-N-cyclopentyl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 47137517 |
| Molecular Formula | C8H11ClN2S |
| Molecular Weight | 202.71 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 2-chloro-N-cyclopentyl-1,3-thiazol-4-amine |
| SMILES | Clc1nc(NC2CCCC2)cs1 |
| InChI | InChI=1S/C8H11ClN2S/c9-8-11-7(5-12-8)10-6-3-1-2-4-6/h5-6,10H,1-4H2 |
| InChIKey | PSWHJFDGZWQZMH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.71 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |