C22H18ClF3N4O — CID 4714892
N-[(4-chlorophenyl)methylideneamino]-4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]benzamide (PubChem CID 4714892) has the molecular formula C22H18ClF3N4O and a molecular weight of 446.86 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methylideneamino]-4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]benzamide.
| Compound Name | N-[(4-chlorophenyl)methylideneamino]-4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]benzamide |
|---|---|
| PubChem CID | 4714892 |
| Molecular Formula | C22H18ClF3N4O |
| Molecular Weight | 446.86 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[(4-chlorophenyl)methylideneamino]-4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]benzamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1)c1ccc(-n2nc(C(F)(F)F)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C22H18ClF3N4O/c23-16-9-5-14(6-10-16)13-27-28-21(31)15-7-11-17(12-8-15)30-19-4-2-1-3-18(19)20(29-30)22(24,25)26/h5-13H,1-4H2,(H,28,31) |
| InChIKey | BSYJSAKHQUFFSM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.86 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|