C11H6ClF3N4OS — CID 86575302
N-[(4-chlorophenyl)methylideneamino]-4-(trifluoromethyl)thiadiazole-5-carboxamide (PubChem CID 86575302) has the molecular formula C11H6ClF3N4OS and a molecular weight of 334.71 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methylideneamino]-4-(trifluoromethyl)thiadiazole-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methylideneamino]-4-(trifluoromethyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 86575302 |
| Molecular Formula | C11H6ClF3N4OS |
| Molecular Weight | 334.71 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | N-[(4-chlorophenyl)methylideneamino]-4-(trifluoromethyl)thiadiazole-5-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1)c1snnc1C(F)(F)F |
| InChI | InChI=1S/C11H6ClF3N4OS/c12-7-3-1-6(2-4-7)5-16-18-10(20)8-9(11(13,14)15)17-19-21-8/h1-5H,(H,18,20) |
| InChIKey | HMNZLLWIOWIOIF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|