C18H20BrN5O2S — CID 4727074
4-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 4727074) has the molecular formula C18H20BrN5O2S and a molecular weight of 450.36 g/mol. Its IUPAC name is 4-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4727074 |
| Molecular Formula | C18H20BrN5O2S |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 4-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1n[nH]c(=S)n1NCc1cc(Br)c(OCc2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C18H20BrN5O2S/c1-3-16-22-23-18(27)24(16)21-10-13-7-14(19)17(15(8-13)25-2)26-11-12-5-4-6-20-9-12/h4-9,21H,3,10-11H2,1-2H3,(H,23,27) |
| InChIKey | SHNBWEVCYOEHBB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|