C14H17ClN2OS2 — CID 47281346
N-[(5-chlorothiophen-2-yl)methyl]-2-[methyl(1-thiophen-2-ylethyl)amino]acetamide (PubChem CID 47281346) has the molecular formula C14H17ClN2OS2 and a molecular weight of 328.89 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-[methyl(1-thiophen-2-ylethyl)amino]acetamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-[methyl(1-thiophen-2-ylethyl)amino]acetamide |
|---|---|
| PubChem CID | 47281346 |
| Molecular Formula | C14H17ClN2OS2 |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-[methyl(1-thiophen-2-ylethyl)amino]acetamide |
| SMILES | CC(c1cccs1)N(C)CC(=O)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H17ClN2OS2/c1-10(12-4-3-7-19-12)17(2)9-14(18)16-8-11-5-6-13(15)20-11/h3-7,10H,8-9H2,1-2H3,(H,16,18) |
| InChIKey | MTUPWRNEOLYIDT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |