C13H14ClNO2S3 — CID 75381770
N-[(5-chlorothiophen-2-yl)methyl]-2-(1-thiophen-2-ylethylsulfinyl)acetamide (PubChem CID 75381770) has the molecular formula C13H14ClNO2S3 and a molecular weight of 347.91 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-(1-thiophen-2-ylethylsulfinyl)acetamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(1-thiophen-2-ylethylsulfinyl)acetamide |
|---|---|
| PubChem CID | 75381770 |
| Molecular Formula | C13H14ClNO2S3 |
| Molecular Weight | 347.91 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(1-thiophen-2-ylethylsulfinyl)acetamide |
| SMILES | CC(c1cccs1)S(=O)CC(=O)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C13H14ClNO2S3/c1-9(11-3-2-6-18-11)20(17)8-13(16)15-7-10-4-5-12(14)19-10/h2-6,9H,7-8H2,1H3,(H,15,16) |
| InChIKey | YQMNLDWJBVUTJV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.91 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |