C15H12ClNO4 — CID 4738063
(4-formyl-2-methoxyphenyl) N-(3-chlorophenyl)carbamate (PubChem CID 4738063) has the molecular formula C15H12ClNO4 and a molecular weight of 305.72 g/mol. Its IUPAC name is (4-formyl-2-methoxyphenyl) N-(3-chlorophenyl)carbamate.
| Compound Name | (4-formyl-2-methoxyphenyl) N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 4738063 |
| Molecular Formula | C15H12ClNO4 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (4-formyl-2-methoxyphenyl) N-(3-chlorophenyl)carbamate |
| SMILES | COc1cc(C=O)ccc1OC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H12ClNO4/c1-20-14-7-10(9-18)5-6-13(14)21-15(19)17-12-4-2-3-11(16)8-12/h2-9H,1H3,(H,17,19) |
| InChIKey | CGLCEHSNZFXCTD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|