C19H22BrClN2O2 — CID 4738644
1-[(4-bromo-2,5-dimethoxyphenyl)-(2-chlorophenyl)methyl]piperazine (PubChem CID 4738644) has the molecular formula C19H22BrClN2O2 and a molecular weight of 425.75 g/mol. Its IUPAC name is 1-[(4-bromo-2,5-dimethoxyphenyl)-(2-chlorophenyl)methyl]piperazine.
| Compound Name | 1-[(4-bromo-2,5-dimethoxyphenyl)-(2-chlorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 4738644 |
| Molecular Formula | C19H22BrClN2O2 |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 1-[(4-bromo-2,5-dimethoxyphenyl)-(2-chlorophenyl)methyl]piperazine |
| SMILES | COc1cc(C(c2ccccc2Cl)N2CCNCC2)c(OC)cc1Br |
| InChI | InChI=1S/C19H22BrClN2O2/c1-24-17-12-15(20)18(25-2)11-14(17)19(23-9-7-22-8-10-23)13-5-3-4-6-16(13)21/h3-6,11-12,19,22H,7-10H2,1-2H3 |
| InChIKey | PLKUCLXYDCLDCD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |