C14H16ClNO4 — CID 47396822
(2-amino-2-oxoethyl) 4-(4-chlorophenyl)oxane-4-carboxylate (PubChem CID 47396822) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 4-(4-chlorophenyl)oxane-4-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 4-(4-chlorophenyl)oxane-4-carboxylate |
|---|---|
| PubChem CID | 47396822 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2-amino-2-oxoethyl) 4-(4-chlorophenyl)oxane-4-carboxylate |
| SMILES | NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCOCC1 |
| InChI | InChI=1S/C14H16ClNO4/c15-11-3-1-10(2-4-11)14(5-7-19-8-6-14)13(18)20-9-12(16)17/h1-4H,5-9H2,(H2,16,17) |
| InChIKey | QYEBSIVSYKXJMV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |