C17H26N4O3 — CID 4740634
4-[4-[1-(4-methoxyphenyl)ethyl]piperazin-1-yl]-4-oxobutanehydrazide (PubChem CID 4740634) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[4-[1-(4-methoxyphenyl)ethyl]piperazin-1-yl]-4-oxobutanehydrazide.
| Compound Name | 4-[4-[1-(4-methoxyphenyl)ethyl]piperazin-1-yl]-4-oxobutanehydrazide |
|---|---|
| PubChem CID | 4740634 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 4-[4-[1-(4-methoxyphenyl)ethyl]piperazin-1-yl]-4-oxobutanehydrazide |
| SMILES | COc1ccc(C(C)N2CCN(C(=O)CCC(=O)NN)CC2)cc1 |
| InChI | InChI=1S/C17H26N4O3/c1-13(14-3-5-15(24-2)6-4-14)20-9-11-21(12-10-20)17(23)8-7-16(22)19-18/h3-6,13H,7-12,18H2,1-2H3,(H,19,22) |
| InChIKey | XUWASBUHUDTXGD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|