C11H16N2O5S — CID 47412717
5-(2,5-dimethylmorpholine-4-carbonyl)furan-2-sulfonamide (PubChem CID 47412717) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 5-(2,5-dimethylmorpholine-4-carbonyl)furan-2-sulfonamide.
| Compound Name | 5-(2,5-dimethylmorpholine-4-carbonyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 47412717 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 5-(2,5-dimethylmorpholine-4-carbonyl)furan-2-sulfonamide |
| SMILES | CC1CN(C(=O)c2ccc(S(N)(=O)=O)o2)C(C)CO1 |
| InChI | InChI=1S/C11H16N2O5S/c1-7-6-17-8(2)5-13(7)11(14)9-3-4-10(18-9)19(12,15)16/h3-4,7-8H,5-6H2,1-2H3,(H2,12,15,16) |
| InChIKey | BWVWIZIYTLHOTP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |