C17H17N3O4 — CID 4744516
4-(2-ethoxynaphthalen-1-yl)-6-methylidene-5-nitro-1,3-diazinan-2-one (PubChem CID 4744516) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-(2-ethoxynaphthalen-1-yl)-6-methylidene-5-nitro-1,3-diazinan-2-one.
| Compound Name | 4-(2-ethoxynaphthalen-1-yl)-6-methylidene-5-nitro-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 4744516 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 4-(2-ethoxynaphthalen-1-yl)-6-methylidene-5-nitro-1,3-diazinan-2-one |
| SMILES | C=C1NC(=O)NC(c2c(OCC)ccc3ccccc23)C1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N3O4/c1-3-24-13-9-8-11-6-4-5-7-12(11)14(13)15-16(20(22)23)10(2)18-17(21)19-15/h4-9,15-16H,2-3H2,1H3,(H2,18,19,21) |
| InChIKey | IKBAZWYHQSAEJI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|