C18H22NO5S- — CID 4748087
6-[(3-ethoxycarbonyl-5-methylthiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 4748087) has the molecular formula C18H22NO5S- and a molecular weight of 364.44 g/mol. Its IUPAC name is 6-[(3-ethoxycarbonyl-5-methylthiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | 6-[(3-ethoxycarbonyl-5-methylthiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 4748087 |
| Molecular Formula | C18H22NO5S- |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 6-[(3-ethoxycarbonyl-5-methylthiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)c1cc(C)sc1NC(=O)C1CC(C)=C(C)CC1C(=O)[O-] |
| InChI | InChI=1S/C18H23NO5S/c1-5-24-18(23)14-8-11(4)25-16(14)19-15(20)12-6-9(2)10(3)7-13(12)17(21)22/h8,12-13H,5-7H2,1-4H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | HUXBYZKEVYINJX-UHFFFAOYSA-M |
| XLogP | 2.28 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|