C20H14ClF2N2O4S- — CID 4748446
(4-chlorophenyl)-[4-[[2-(difluoromethoxy)benzoyl]amino]phenyl]sulfonylazanide (PubChem CID 4748446) has the molecular formula C20H14ClF2N2O4S- and a molecular weight of 451.86 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-[[2-(difluoromethoxy)benzoyl]amino]phenyl]sulfonylazanide.
| Compound Name | (4-chlorophenyl)-[4-[[2-(difluoromethoxy)benzoyl]amino]phenyl]sulfonylazanide |
|---|---|
| PubChem CID | 4748446 |
| Molecular Formula | C20H14ClF2N2O4S- |
| Molecular Weight | 451.86 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | (4-chlorophenyl)-[4-[[2-(difluoromethoxy)benzoyl]amino]phenyl]sulfonylazanide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)[N-]c2ccc(Cl)cc2)cc1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C20H14ClF2N2O4S/c21-13-5-7-15(8-6-13)25-30(27,28)16-11-9-14(10-12-16)24-19(26)17-3-1-2-4-18(17)29-20(22)23/h1-12,20H,(H,24,26)/q-1 |
| InChIKey | GZSQMNBAYYVFSQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 86.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.86 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |