C17H17FN4O2S2 — CID 47501801
5-[3-(4-fluorophenyl)sulfonylpropylsulfanyl]-1-(3-methylphenyl)tetrazole (PubChem CID 47501801) has the molecular formula C17H17FN4O2S2 and a molecular weight of 392.48 g/mol. Its IUPAC name is 5-[3-(4-fluorophenyl)sulfonylpropylsulfanyl]-1-(3-methylphenyl)tetrazole.
| Compound Name | 5-[3-(4-fluorophenyl)sulfonylpropylsulfanyl]-1-(3-methylphenyl)tetrazole |
|---|---|
| PubChem CID | 47501801 |
| Molecular Formula | C17H17FN4O2S2 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 5-[3-(4-fluorophenyl)sulfonylpropylsulfanyl]-1-(3-methylphenyl)tetrazole |
| SMILES | Cc1cccc(-n2nnnc2SCCCS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H17FN4O2S2/c1-13-4-2-5-15(12-13)22-17(19-20-21-22)25-10-3-11-26(23,24)16-8-6-14(18)7-9-16/h2,4-9,12H,3,10-11H2,1H3 |
| InChIKey | MKJCNSFDVCMYHZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|