C13H13FN6S — CID 75505518
1-(3-fluorophenyl)-5-(3-imidazol-1-ylpropylsulfanyl)tetrazole (PubChem CID 75505518) has the molecular formula C13H13FN6S and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-5-(3-imidazol-1-ylpropylsulfanyl)tetrazole.
| Compound Name | 1-(3-fluorophenyl)-5-(3-imidazol-1-ylpropylsulfanyl)tetrazole |
|---|---|
| PubChem CID | 75505518 |
| Molecular Formula | C13H13FN6S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-(3-fluorophenyl)-5-(3-imidazol-1-ylpropylsulfanyl)tetrazole |
| SMILES | Fc1cccc(-n2nnnc2SCCCn2ccnc2)c1 |
| InChI | InChI=1S/C13H13FN6S/c14-11-3-1-4-12(9-11)20-13(16-17-18-20)21-8-2-6-19-7-5-15-10-19/h1,3-5,7,9-10H,2,6,8H2 |
| InChIKey | ZUUGWFRDXZWPKH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|