C23H21N5O4S3 — CID 4756791
N'-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]-2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetohydrazide (PubChem CID 4756791) has the molecular formula C23H21N5O4S3 and a molecular weight of 527.65 g/mol. Its IUPAC name is N'-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]-2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetohydrazide.
| Compound Name | N'-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]-2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 4756791 |
| Molecular Formula | C23H21N5O4S3 |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | N'-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]-2-[5-[(4-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetohydrazide |
| SMILES | CCOc1ccc(C=C2SC(=S)N(CC(=O)NNC(=O)CSc3nc4ccccc4[nH]3)C2=O)cc1 |
| InChI | InChI=1S/C23H21N5O4S3/c1-2-32-15-9-7-14(8-10-15)11-18-21(31)28(23(33)35-18)12-19(29)26-27-20(30)13-34-22-24-16-5-3-4-6-17(16)25-22/h3-11H,2,12-13H2,1H3,(H,24,25)(H,26,29)(H,27,30) |
| InChIKey | WVXZGWXHHKLDJM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|