C16H18N4O4 — CID 47584978
2-(pyridine-4-carbonylamino)ethyl 6-oxo-1-propylpyridazine-3-carboxylate (PubChem CID 47584978) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-(pyridine-4-carbonylamino)ethyl 6-oxo-1-propylpyridazine-3-carboxylate.
| Compound Name | 2-(pyridine-4-carbonylamino)ethyl 6-oxo-1-propylpyridazine-3-carboxylate |
|---|---|
| PubChem CID | 47584978 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-(pyridine-4-carbonylamino)ethyl 6-oxo-1-propylpyridazine-3-carboxylate |
| SMILES | CCCn1nc(C(=O)OCCNC(=O)c2ccncc2)ccc1=O |
| InChI | InChI=1S/C16H18N4O4/c1-2-10-20-14(21)4-3-13(19-20)16(23)24-11-9-18-15(22)12-5-7-17-8-6-12/h3-8H,2,9-11H2,1H3,(H,18,22) |
| InChIKey | UGJJYGTUCDOOJS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|