C14H14N2O4S — CID 4763480
[3-acetyl-2-(4-methoxyphenyl)imino-1,3-thiazol-4-yl] acetate (PubChem CID 4763480) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is [3-acetyl-2-(4-methoxyphenyl)imino-1,3-thiazol-4-yl] acetate.
| Compound Name | [3-acetyl-2-(4-methoxyphenyl)imino-1,3-thiazol-4-yl] acetate |
|---|---|
| PubChem CID | 4763480 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | [3-acetyl-2-(4-methoxyphenyl)imino-1,3-thiazol-4-yl] acetate |
| SMILES | COc1ccc(/N=c2\scc(OC(C)=O)n2C(C)=O)cc1 |
| InChI | InChI=1S/C14H14N2O4S/c1-9(17)16-13(20-10(2)18)8-21-14(16)15-11-4-6-12(19-3)7-5-11/h4-8H,1-3H3/b15-14- |
| InChIKey | WWSIKHYIKKITMN-PFONDFGASA-N |
| XLogP | 2.38 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |