C14H9BrI2O2 — CID 4767295
2-[(3-bromophenyl)methoxy]-3,5-diiodobenzaldehyde (PubChem CID 4767295) has the molecular formula C14H9BrI2O2 and a molecular weight of 542.94 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methoxy]-3,5-diiodobenzaldehyde.
| Compound Name | 2-[(3-bromophenyl)methoxy]-3,5-diiodobenzaldehyde |
|---|---|
| PubChem CID | 4767295 |
| Molecular Formula | C14H9BrI2O2 |
| Molecular Weight | 542.94 g/mol |
| Exact Mass | 541.79 |
| IUPAC Name | 2-[(3-bromophenyl)methoxy]-3,5-diiodobenzaldehyde |
| SMILES | O=Cc1cc(I)cc(I)c1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C14H9BrI2O2/c15-11-3-1-2-9(4-11)8-19-14-10(7-18)5-12(16)6-13(14)17/h1-7H,8H2 |
| InChIKey | YNOCKRMXZUEYJL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|