C14H8Cl2I2O2 — CID 4767221
2-[(2,6-dichlorophenyl)methoxy]-3,5-diiodobenzaldehyde (PubChem CID 4767221) has the molecular formula C14H8Cl2I2O2 and a molecular weight of 532.93 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methoxy]-3,5-diiodobenzaldehyde.
| Compound Name | 2-[(2,6-dichlorophenyl)methoxy]-3,5-diiodobenzaldehyde |
|---|---|
| PubChem CID | 4767221 |
| Molecular Formula | C14H8Cl2I2O2 |
| Molecular Weight | 532.93 g/mol |
| Exact Mass | 531.80 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methoxy]-3,5-diiodobenzaldehyde |
| SMILES | O=Cc1cc(I)cc(I)c1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H8Cl2I2O2/c15-11-2-1-3-12(16)10(11)7-20-14-8(6-19)4-9(17)5-13(14)18/h1-6H,7H2 |
| InChIKey | FNKALWHYYPUVQG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.93 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|