C24H24N10 — CID 4776675
10-methyl-4-[3-(5-phenyltetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4776675) has the molecular formula C24H24N10 and a molecular weight of 452.53 g/mol. Its IUPAC name is 10-methyl-4-[3-(5-phenyltetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-methyl-4-[3-(5-phenyltetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4776675 |
| Molecular Formula | C24H24N10 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 10-methyl-4-[3-(5-phenyltetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cn1ncc2c1ncn1nc(C34CC5CC(C3)CC(n3nnc(-c6ccccc6)n3)(C5)C4)nc21 |
| InChI | InChI=1S/C24H24N10/c1-32-20-18(12-26-32)21-27-22(30-33(21)14-25-20)23-8-15-7-16(9-23)11-24(10-15,13-23)34-29-19(28-31-34)17-5-3-2-4-6-17/h2-6,12,14-16H,7-11,13H2,1H3 |
| InChIKey | VRWICNFCUIARMG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 104.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |