C16H21F2N5O2 — CID 47770930
2-(5-tert-butyltetrazol-1-yl)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide (PubChem CID 47770930) has the molecular formula C16H21F2N5O2 and a molecular weight of 353.37 g/mol. Its IUPAC name is 2-(5-tert-butyltetrazol-1-yl)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide.
| Compound Name | 2-(5-tert-butyltetrazol-1-yl)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 47770930 |
| Molecular Formula | C16H21F2N5O2 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-(5-tert-butyltetrazol-1-yl)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)Cn1nnnc1C(C)(C)C |
| InChI | InChI=1S/C16H21F2N5O2/c1-16(2,3)14-19-20-21-23(14)10-13(24)22(4)9-11-5-7-12(8-6-11)25-15(17)18/h5-8,15H,9-10H2,1-4H3 |
| InChIKey | YTFQHQZEYSDBHC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |