C16H16N8O2S2 — CID 47773003
2-amino-5-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 47773003) has the molecular formula C16H16N8O2S2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 2-amino-5-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-amino-5-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 47773003 |
| Molecular Formula | C16H16N8O2S2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-amino-5-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCOc1ccccc1Nc1nnc(SCc2cc(=O)n3[nH]c(N)nc3n2)s1 |
| InChI | InChI=1S/C16H16N8O2S2/c1-2-26-11-6-4-3-5-10(11)19-15-21-22-16(28-15)27-8-9-7-12(25)24-14(18-9)20-13(17)23-24/h3-7H,2,8H2,1H3,(H,19,21)(H3,17,18,20,23) |
| InChIKey | MNCJZOZEUFYBBL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 136.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |