C23H23N5O4S2 — CID 4780641
2-(6-ethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 4780641) has the molecular formula C23H23N5O4S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 2-(6-ethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | 2-(6-ethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 4780641 |
| Molecular Formula | C23H23N5O4S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-(6-ethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NN2C(=O)NC(C)(c3ccccc3)C2=O)nc2sc(CC)cc2c1=O |
| InChI | InChI=1S/C23H23N5O4S2/c1-4-11-27-19(30)16-12-15(5-2)34-18(16)24-22(27)33-13-17(29)26-28-20(31)23(3,25-21(28)32)14-9-7-6-8-10-14/h4,6-10,12H,1,5,11,13H2,2-3H3,(H,25,32)(H,26,29) |
| InChIKey | DNHMVOCYYSKWGU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|