C21H15ClN2O3 — CID 4785529
2-(2-acetylnaphthalen-1-yl)oxy-N-(3-chloro-4-cyanophenyl)acetamide (PubChem CID 4785529) has the molecular formula C21H15ClN2O3 and a molecular weight of 378.82 g/mol. Its IUPAC name is 2-(2-acetylnaphthalen-1-yl)oxy-N-(3-chloro-4-cyanophenyl)acetamide.
| Compound Name | 2-(2-acetylnaphthalen-1-yl)oxy-N-(3-chloro-4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 4785529 |
| Molecular Formula | C21H15ClN2O3 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-(2-acetylnaphthalen-1-yl)oxy-N-(3-chloro-4-cyanophenyl)acetamide |
| SMILES | CC(=O)c1ccc2ccccc2c1OCC(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C21H15ClN2O3/c1-13(25)17-9-7-14-4-2-3-5-18(14)21(17)27-12-20(26)24-16-8-6-15(11-23)19(22)10-16/h2-10H,12H2,1H3,(H,24,26) |
| InChIKey | IHOWAGOHBDDVPJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |