C16H15F3N2O2S — CID 47859052
N-[2-(2-methylphenoxy)ethyl]-2-(trifluoromethylsulfanyl)pyridine-3-carboxamide (PubChem CID 47859052) has the molecular formula C16H15F3N2O2S and a molecular weight of 356.37 g/mol. Its IUPAC name is N-[2-(2-methylphenoxy)ethyl]-2-(trifluoromethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(2-methylphenoxy)ethyl]-2-(trifluoromethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47859052 |
| Molecular Formula | C16H15F3N2O2S |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-[2-(2-methylphenoxy)ethyl]-2-(trifluoromethylsulfanyl)pyridine-3-carboxamide |
| SMILES | Cc1ccccc1OCCNC(=O)c1cccnc1SC(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O2S/c1-11-5-2-3-7-13(11)23-10-9-20-14(22)12-6-4-8-21-15(12)24-16(17,18)19/h2-8H,9-10H2,1H3,(H,20,22) |
| InChIKey | YVSFHQKOTHYPFJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|