C25H23N5O4S — CID 4789077
3-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]quinazolin-4-one (PubChem CID 4789077) has the molecular formula C25H23N5O4S and a molecular weight of 489.56 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 4789077 |
| Molecular Formula | C25H23N5O4S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C25H23N5O4S/c31-24-20-8-4-5-9-21(20)26-25(29(24)15-14-17-6-2-1-3-7-17)35-16-22-27-28-23(34-22)18-10-12-19(13-11-18)30(32)33/h4-6,8-13H,1-3,7,14-16H2 |
| InChIKey | SVPHGOJBRSQJAG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|