C19H24Cl2N4O3 — CID 4789849
N-(2,5-dichlorophenyl)-2-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)methyl-propylamino]acetamide (PubChem CID 4789849) has the molecular formula C19H24Cl2N4O3 and a molecular weight of 427.33 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)methyl-propylamino]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)methyl-propylamino]acetamide |
|---|---|
| PubChem CID | 4789849 |
| Molecular Formula | C19H24Cl2N4O3 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)methyl-propylamino]acetamide |
| SMILES | CCCN(CC(=O)Nc1cc(Cl)ccc1Cl)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C19H24Cl2N4O3/c1-2-9-24(11-16(26)22-15-10-13(20)5-6-14(15)21)12-25-17(27)19(23-18(25)28)7-3-4-8-19/h5-6,10H,2-4,7-9,11-12H2,1H3,(H,22,26)(H,23,28) |
| InChIKey | RCGWGILSAFTLME-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|