C17H20BrN3O2 — CID 47923606
1-[4-(3-bromo-1-methylindole-2-carbonyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 47923606) has the molecular formula C17H20BrN3O2 and a molecular weight of 378.27 g/mol. Its IUPAC name is 1-[4-(3-bromo-1-methylindole-2-carbonyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(3-bromo-1-methylindole-2-carbonyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 47923606 |
| Molecular Formula | C17H20BrN3O2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 1-[4-(3-bromo-1-methylindole-2-carbonyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(C(=O)c2c(Br)c3ccccc3n2C)CC1 |
| InChI | InChI=1S/C17H20BrN3O2/c1-12(22)20-8-5-9-21(11-10-20)17(23)16-15(18)13-6-3-4-7-14(13)19(16)2/h3-4,6-7H,5,8-11H2,1-2H3 |
| InChIKey | JZXVGATZBMXDAQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |