C19H16F2N4O3S — CID 4793489
N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2,4-difluorobenzamide (PubChem CID 4793489) has the molecular formula C19H16F2N4O3S and a molecular weight of 418.43 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 4793489 |
| Molecular Formula | C19H16F2N4O3S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2,4-difluorobenzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(F)cc3F)cc2)nc(C)n1 |
| InChI | InChI=1S/C19H16F2N4O3S/c1-11-9-18(23-12(2)22-11)25-29(27,28)15-6-4-14(5-7-15)24-19(26)16-8-3-13(20)10-17(16)21/h3-10H,1-2H3,(H,24,26)(H,22,23,25) |
| InChIKey | ZXHISWBSIMUVCQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |